"""
Module for handling molecules.
"""
import importlib.resources
import os
import re
from copy import deepcopy
from operator import itemgetter
import networkx as nx
import numpy as np
from monty.serialization import loadfn
from numpy.random import Generator
from pymatgen.core.structure import Molecule
from pymatgen.symmetry.analyzer import PointGroupAnalyzer, generate_full_symmops
from scipy.spatial.distance import cdist
from scipy.spatial.transform import Rotation
from pyxtal.constants import single_smiles
from pyxtal.database.collection import Collection
from pyxtal.database.element import Element
from pyxtal.msg import AtomTypeError, ConformerError
from pyxtal.operations import OperationAnalyzer, SymmOp, angle, rotate_vector
from pyxtal.symmetry import Group
from pyxtal.tolerance import Tol_matrix
with importlib.resources.as_file(importlib.resources.files("pyxtal") / "database" / "bonds.json") as path:
bonds = loadfn(path)
molecule_collection = Collection("molecules")
[docs]
def find_rotor_from_smile(smile):
"""
Find the positions of rotatable bonds based on a SMILES string.
Rotatable bonds are those which are not part of rings and which
fit specific chemical patterns. These torsions are filtered by
rules such as avoiding atoms with only one neighbor and avoiding
equivalent torsions.
Args:
smile (str): The SMILES string representing the molecule.
Returns:
list of tuples: Each tuple represents a torsion as (i, j, k, l)
where i-j-k-l are atom indices involved in the rotatable bond.
"""
def cleaner(list_to_clean, neighbors):
"""
Remove duplicate and invalid torsions from a list of atom index tuples.
Filters torsions based on the neighbors count for the atoms involved in the torsion.
This avoids torsions that involve terminal atoms and duplicates.
Args:
list_to_clean (list of tuples): List of torsions (i, j, k, l)
neighbors (list of int): List of neighbors for each atom in the molecule.
Returns:
list of tuples: Cleaned list of torsions.
"""
for_remove = []
for x in reversed(range(len(list_to_clean))):
ix0 = itemgetter(0)(list_to_clean[x])
ix1 = itemgetter(0)(list_to_clean[x])
ix2 = itemgetter(0)(list_to_clean[x])
ix3 = itemgetter(3)(list_to_clean[x])
# for i-j-k-l, we don't want i, l are the ending members
# C-C-S=O is not a good choice since O is only 1-coordinated
# C-C-NO2 is a good choice since O is only 1-coordinated
# Remove torsions that involve terminal atoms with only one neighbor
if neighbors[ix0] == 1 and neighbors[ix1] == 2 or neighbors[ix3] == 1 and neighbors[ix2] == 2:
for_remove.append(x)
else:
# Remove duplicate torsions that are equivalent
for y in reversed(range(x)):
ix1 = itemgetter(1)(list_to_clean[x])
ix2 = itemgetter(2)(list_to_clean[x])
iy1 = itemgetter(1)(list_to_clean[y])
iy2 = itemgetter(2)(list_to_clean[y])
if [ix1, ix2] == [iy1, iy2] or [ix1, ix2] == [iy2, iy1]:
for_remove.append(y)
clean_list = []
for i, v in enumerate(list_to_clean):
if i not in set(for_remove):
clean_list.append(v)
return clean_list
if smile in ["Cl-", "F-", "Br-", "I-", "Li+", "Na+"]:
return []
else:
from rdkit import Chem
# SMARTS patterns to identify rotatable bonds and double bonds
smarts_torsion1 = "[*]~[!$(*#*)&!D1]-&!@[!$(*#*)&!D1]~[*]"
smarts_torsion2 = "[*]~[^2]=[^2]~[*]" # C=C bonds
# smarts_torsion2="[*]~[^1]#[^1]~[*]" # C-C triples bonds, to be fixed
mol = Chem.MolFromSmiles(smile)
mol_with_H = Chem.AddHs(mol)
N_atom = mol.GetNumAtoms()
neighbors = [len(a.GetNeighbors()) for a in mol_with_H.GetAtoms()][:N_atom]
# make sure that the ending members will be counted
# neighbors[0] += 1; neighbors[-1] += 1
patn_tor1 = Chem.MolFromSmarts(smarts_torsion1)
torsion1 = cleaner(list(mol.GetSubstructMatches(patn_tor1)), neighbors)
patn_tor2 = Chem.MolFromSmarts(smarts_torsion2)
torsion2 = cleaner(list(mol.GetSubstructMatches(patn_tor2)), neighbors)
# Combine and clean torsions
tmp = cleaner(torsion1 + torsion2, neighbors)
# Exclude torsions that are part of rings
torsions = []
for t in tmp:
(i, j, k, l) = t
b = mol.GetBondBetweenAtoms(j, k)
if not b.IsInRing():
torsions.append(t)
# if len(torsions) > 6: torsions[1] = (4, 7, 10, 15)
return torsions # + [(6, 7, 8, 3), (6, 5, 4, 3)]
[docs]
def has_non_aromatic_ring(smiles):
"""
Determine if a molecule has a non-aromatic ring.
It checks if a cyclic ring system exists that is not aromatic.
Args:
smiles (str): A SMILES string representing the molecule.
Returns:
bool: True if it contains a non-aromatic ring, False otherwise.
"""
from rdkit import Chem
# Convert the SMILES string to an RDKit molecule object
mol = Chem.MolFromSmiles(smiles)
# Check if the molecule has rings at all
if not mol.HasSubstructMatch(Chem.MolFromSmarts("[R]")):
return False # No rings present
# Get information about the rings in the molecule
ring_info = mol.GetRingInfo()
# Check each ring to see if it is aromatic; return True if a non-aromatic ring is found
return any(
not all(mol.GetBondWithIdx(idx).GetIsAromatic() for idx in ring) for ring in ring_info.BondRings()
) # No non-aromatic rings found
def _is_charged_smiles(smile):
"""True if SMILES encodes a nonzero formal charge (e.g. [NH2+], [O-]).
Uses RDKit formal charges when available. Avoids false positives from
stereo atoms like ``[C@]`` combined with single-bond ``-`` characters.
"""
import re
try:
from rdkit import Chem
mol = Chem.MolFromSmiles(smile)
if mol is not None:
return any(a.GetFormalCharge() != 0 for a in mol.GetAtoms())
except Exception:
pass
# Fallback: charge inside brackets only, e.g. [NH2+], [O-], [Fe+3]
return bool(re.search(r"\[[^\]]*[+-]\d*\]", smile))
def _count_heavy_atoms_smiles(smile):
"""Heavy-atom count from SMILES (H stripped). Falls back to 0 on parse failure."""
try:
from rdkit import Chem
mol = Chem.MolFromSmiles(smile)
if mol is None:
return 0
return int(mol.GetNumHeavyAtoms())
except Exception:
return 0
def _default_n_extra(n_tor, charged=False, mode="grid"):
if mode in ("anti_bias", "parent_flip", "mixed_chain"):
# Need room for evenly spaced parents × rotors × ±90 snaps
return min(96, max(48, 8 * n_tor))
if n_tor >= 10:
return 32
if n_tor >= 6:
return 24
if n_tor >= 3 or charged:
return 24
return 12
def _commit_extras(mols, extras, n_extra, dedupe_tol):
"""Append unique extras onto ``mols`` (in place), up to ``n_extra``."""
n_added = 0
for m in extras:
if n_added >= n_extra:
break
keep = True
for ref in mols:
try:
rms, _ = m.get_rmsd2(m.mol.cart_coords, ref.mol.cart_coords)
except Exception:
continue
if rms < dedupe_tol:
keep = False
break
if keep:
mols.append(m)
n_added += 1
return n_added
def _append_anti_bias_extras(
mols,
m0,
torsionlist,
wps=None,
n_extra=32,
dedupe_tol=0.35,
seed0=99,
refine_mmff=False,
):
"""
Append alkyl-chain-friendly conformers for bulky many-rotor molecules.
Crystal long chains (e.g. YOKBIK) are often all-trans (±180°). Random torsion
grids and MMFF both undersample this; seeding ±180° then flipping one rotor
at a time recovers crystal-like geometries without exploding the pool.
"""
import numpy as np
from rdkit.Geometry import Point3D
if n_extra <= 0 or not torsionlist:
return mols
n_tor = len(torsionlist)
extras = []
rng = np.random.default_rng(seed0)
def _try_add(m, xyz):
_, ok = m.get_orientations_in_wps(wps)
if not ok:
return False
for existing in list(mols) + extras:
try:
rms, _ = existing.get_rmsd2(xyz, existing.mol.cart_coords)
except Exception:
continue
if rms < dedupe_tol:
return False
extras.append(m)
return True
def _apply_angles(angs, xyz_src=None):
m = m0.copy()
rdmol = m.rdkit_mol(1)
conf = rdmol.GetConformer(0)
if xyz_src is None:
xyz_src = np.array(m0.mol.cart_coords, dtype=float)
for ai in range(min(len(xyz_src), rdmol.GetNumAtoms())):
conf.SetAtomPosition(ai, Point3D(*xyz_src[ai]))
xyz = m.set_torsion_angles(conf, list(angs))
if refine_mmff:
try:
xyz, eng = m.relax(xyz, align=False)
m.energy = eng
except Exception:
pass
m.reset_positions(xyz)
_try_add(m, xyz)
# All-trans seeds (both signs)
for base_ang in (180.0, -180.0):
_apply_angles([base_ang] * n_tor)
# Single-rotor flips from all-trans
deltas = (-120.0, -60.0, 60.0, 120.0)
for i in range(n_tor):
for d in deltas:
angs = [180.0] * n_tor
angs[i] = 180.0 + d
_apply_angles(angs)
if len(extras) >= n_extra * 3:
break
if len(extras) >= n_extra * 3:
break
# Sparse two-rotor flips (adjacent + random)
if len(extras) < n_extra * 3:
for _ in range(min(2 * n_tor, 40)):
angs = [180.0] * n_tor
i = int(rng.integers(0, n_tor))
j = (i + 1) % n_tor if rng.random() < 0.7 else int(rng.integers(0, n_tor))
angs[i] = 180.0 + float(rng.choice(deltas))
angs[j] = 180.0 + float(rng.choice(deltas))
_apply_angles(angs)
if len(extras) >= n_extra * 3:
break
_commit_extras(mols, extras, n_extra, dedupe_tol)
return mols
def _append_parent_flip_extras(
mols,
m0,
torsionlist,
wps=None,
n_extra=64,
dedupe_tol=0.35,
seed0=101,
refine_mmff=False,
n_parents=None,
walk_steps=4,
walks_per_parent=4,
):
"""
Perturb MMFF parents for gauche / mixed-dihedral crystals (OBEQIX).
Absolute snaps (not relative ±180) matter: e.g. −82° → +82°. Generate every
parent × rotor × key level, then commit with **evenly spaced parents** so a
late best-MMFF parent is not dropped (OBEQIX best was index 25/38).
"""
import numpy as np
from rdkit.Geometry import Point3D
if n_extra <= 0 or not torsionlist or not mols:
return mols
n_tor = len(torsionlist)
if n_parents is None:
n_parents = len(mols)
n_parents = min(int(n_parents), len(mols))
extras = []
snap_levels = (-180.0, -90.0, 0.0, 90.0, 180.0)
# by_rotor_lev[i][lev][pi] aligned to ``parents`` index (None if missing)
by_rotor_lev = {
i: {lev: [None] * n_parents for lev in snap_levels} for i in range(n_tor)
}
walk_pool = []
rng = np.random.default_rng(seed0)
levels = (-180.0, -150.0, -120.0, -90.0, -60.0, -30.0, 0.0,
30.0, 60.0, 90.0, 120.0, 150.0, 180.0)
parents = list(mols[:n_parents])
def _try_add(m, xyz):
_, ok = m.get_orientations_in_wps(wps)
if not ok:
return False
for existing in list(mols) + extras:
try:
rms, _ = existing.get_rmsd2(xyz, existing.mol.cart_coords)
except Exception:
continue
if rms < dedupe_tol:
return False
extras.append(m)
return True
def _build(parent, angs):
m = m0.copy()
rdmol = m.rdkit_mol(1)
conf = rdmol.GetConformer(0)
xyz_src = np.array(parent.mol.cart_coords, dtype=float)
for ai in range(min(len(xyz_src), rdmol.GetNumAtoms())):
conf.SetAtomPosition(ai, Point3D(*xyz_src[ai]))
xyz = m.set_torsion_angles(conf, list(angs))
if refine_mmff:
try:
xyz, eng = m.relax(xyz, align=False)
m.energy = eng
except Exception:
pass
m.reset_positions(xyz)
if _try_add(m, xyz):
return m
return None
def _parent_angs(parent):
try:
angs0 = [float(a) for a in parent.get_torsion_angles()]
except Exception:
return None
if len(angs0) < n_tor:
return None
return angs0[:n_tor]
# 1) Full snaps — store by parent index
for pi, parent in enumerate(parents):
angs0 = _parent_angs(parent)
if angs0 is None:
continue
for i in range(n_tor):
for lev in snap_levels:
angs = list(angs0)
angs[i] = lev
m = _build(parent, angs)
if m is not None:
by_rotor_lev[i][lev][pi] = m
# 2) Short absolute multi-rotor walks
for parent in parents:
angs0 = _parent_angs(parent)
if angs0 is None:
continue
for _walk in range(walks_per_parent):
angs = list(angs0)
for _step in range(walk_steps):
ii = int(rng.integers(0, n_tor))
angs[ii] = float(rng.choice(levels))
m = _build(parent, angs)
if m is not None:
walk_pool.append(m)
# 3) Commit: evenly spaced parents × all rotors × preferred levels
# Cost per (parent, level) = n_tor; fit as many parents as budget allows.
prefer_lev = (90.0, -90.0, 180.0, -180.0, 0.0)
slots_per_parent_level = n_tor
# at least cover ±90 for several parents including ends
max_parents = max(4, n_extra // max(1, slots_per_parent_level))
# use two preferred levels in first pass when budget allows
n_lev_first = 2 if n_extra >= 2 * slots_per_parent_level * 4 else 1
k = max(4, n_extra // max(1, slots_per_parent_level * n_lev_first))
k = min(k, len(parents))
parent_idxs = np.unique(
np.linspace(0, len(parents) - 1, k).round().astype(int)
)
selected = []
seen = set()
def _push(m):
if m is None:
return
mid = id(m)
if mid in seen:
return
seen.add(mid)
selected.append(m)
for lev in prefer_lev[:n_lev_first]:
for pi in parent_idxs:
for i in range(n_tor):
_push(by_rotor_lev[i][lev][pi])
if len(selected) >= n_extra:
break
if len(selected) >= n_extra:
break
if len(selected) >= n_extra:
break
# Fill remainder with other levels / walks
if len(selected) < n_extra:
for lev in prefer_lev[n_lev_first:]:
for pi in parent_idxs:
for i in range(n_tor):
_push(by_rotor_lev[i][lev][pi])
if len(selected) >= n_extra:
break
if len(selected) >= n_extra:
break
if len(selected) >= n_extra:
break
if len(selected) < n_extra:
for m in walk_pool:
_push(m)
if len(selected) >= n_extra:
break
_commit_extras(mols, selected, n_extra, dedupe_tol)
return mols
def _append_mixed_chain_extras(
mols,
m0,
torsionlist,
wps=None,
n_extra=48,
dedupe_tol=0.35,
seed0=99,
refine_mmff=False,
):
"""
Combine anti-bias (YOKBIK / all-trans) with parent-flip (OBEQIX / gauche).
Allocates roughly 1/3 of the budget to anti-bias and 2/3 to parent-flip so
gauche crystals get more searches around MMFF parents.
"""
if n_extra <= 0 or not torsionlist:
return mols
n_anti = max(8, n_extra // 4)
n_flip = max(32, n_extra - n_anti)
_append_anti_bias_extras(
mols,
m0,
torsionlist,
wps=wps,
n_extra=n_anti,
dedupe_tol=dedupe_tol,
seed0=seed0,
refine_mmff=refine_mmff,
)
_append_parent_flip_extras(
mols,
m0,
torsionlist,
wps=wps,
n_extra=n_flip,
dedupe_tol=dedupe_tol,
seed0=seed0 + 2,
refine_mmff=refine_mmff,
n_parents=len(mols),
walk_steps=4,
walks_per_parent=4,
)
return mols
def _append_torsion_extras(
mols,
m0,
smile,
torsionlist,
wps=None,
n_extra=24,
grid_step=90,
dedupe_tol=0.35,
max_grid=400,
seed0=99,
keep_raw=None,
refine_mmff=False,
):
"""
Append crystal-like conformers that FF minimization often discards.
Strategy (does not remove existing ``mols``):
1. Coarse {-180, 0}^n torsion grid (when small)
2. Discrete torsion grid / parent-torsion perturbations
3. Optional raw ETKDG embeddings when ``keep_raw`` (charged organics)
If ``refine_mmff`` is True, each grid candidate is MMFF-relaxed before
accept/reject (safer for neutrals; inappropriate for charged off-minima cases).
"""
import itertools
import numpy as np
from rdkit import Chem
from rdkit.Chem import AllChem
from rdkit.Geometry import Point3D
if n_extra <= 0 or not torsionlist:
return mols
n_tor = len(torsionlist)
charged = _is_charged_smiles(smile)
if keep_raw is None:
keep_raw = charged and not refine_mmff
extras = []
def _try_add(m, xyz):
_, ok = m.get_orientations_in_wps(wps)
if not ok:
return False
for existing in list(mols) + extras:
try:
rms, _ = existing.get_rmsd2(xyz, existing.mol.cart_coords)
except Exception:
continue
if rms < dedupe_tol:
return False
extras.append(m)
return True
def _apply_angles(angs, xyz_src=None):
m = m0.copy()
rdmol = m.rdkit_mol(1)
conf = rdmol.GetConformer(0)
if xyz_src is None:
xyz_src = np.array(m0.mol.cart_coords, dtype=float)
for ai in range(min(len(xyz_src), rdmol.GetNumAtoms())):
conf.SetAtomPosition(ai, Point3D(*xyz_src[ai]))
xyz = m.set_torsion_angles(conf, list(angs))
if refine_mmff:
try:
xyz, eng = m.relax(xyz, align=False)
m.energy = eng
except Exception:
pass
m.reset_positions(xyz)
# Skip get_symmetry: can hang for some small acids (e.g. oxalic at -90°)
_try_add(m, xyz)
# 1) Coarse {-180, 0}^n — catches crystal torsions near 0/180 (e.g. XAFQON)
coarse = (-180.0, 0.0)
if n_tor <= 6 and (2 ** n_tor) <= max_grid:
for angs in itertools.product(coarse, repeat=n_tor):
_apply_angles(angs)
if len(extras) >= n_extra * 3:
break
# 2) Full / sampled grid at ``grid_step``
levels = [float(x) for x in range(-180, 180, int(grid_step))]
n_levels = len(levels)
total = n_levels ** n_tor
rng = np.random.default_rng(seed0)
if total <= max_grid:
for angs in itertools.product(levels, repeat=n_tor):
_apply_angles(angs)
if len(extras) >= n_extra * 3:
break
else:
parents = mols[: min(16, len(mols))]
for k in range(max_grid):
if parents and (k % 2 == 0):
parent = parents[int(rng.integers(0, len(parents)))]
try:
angs0 = parent.get_torsion_angles()
if not angs0:
continue
angs = [
float(a) + float(rng.choice([-90.0, 90.0, 180.0]))
for a in angs0
]
_apply_angles(angs, xyz_src=np.array(parent.mol.cart_coords, dtype=float))
except Exception:
continue
else:
angs = [levels[int(rng.integers(0, n_levels))] for _ in range(n_tor)]
_apply_angles(angs)
if len(extras) >= n_extra * 3:
break
# 3) Raw ETKDG (no MMFF) — useful when crystal packs off FF minima
if keep_raw:
n_embed = max(4, n_tor)
for i in range(max(4, n_tor)):
mol = Chem.MolFromSmiles(smile)
mol = Chem.AddHs(mol)
ps = AllChem.ETKDGv3()
ps.randomSeed = int(seed0 + 1000 + i)
ps.pruneRmsThresh = max(0.2, dedupe_tol)
ps.numThreads = 1
if charged:
ps.useRandomCoords = True
AllChem.EmbedMultipleConfs(mol, n_embed, ps)
for conf in mol.GetConformers():
m = m0.copy()
try:
xyz = m.align(conf)
m.reset_positions(xyz)
except Exception:
continue
_try_add(m, xyz)
if len(extras) >= n_extra * 3:
break
if len(extras) >= n_extra * 3:
break
# Keep baseline order; append unique extras up to n_extra
n_added = 0
for m in extras:
if n_added >= n_extra:
break
keep = True
for ref in mols:
try:
rms, _ = m.get_rmsd2(m.mol.cart_coords, ref.mol.cart_coords)
except Exception:
continue
if rms < dedupe_tol:
keep = False
break
if keep:
mols.append(m)
n_added += 1
return mols
[docs]
def generate_molecules(
smile,
wps=None,
N_iter=5,
N_conf=10,
tol=0.5,
use_uff=False,
torsion_extras="auto",
n_extra=None,
grid_step=90,
verbose=False,
):
"""
Generate :class:`pyxtal_molecule` conformers from a SMILES string.
Pipeline:
1. ETKDG + MMFF/UFF (baseline force-field pool)
2. Optional torsion-grid / raw-ETKDG extras. Baseline conformers are never
discarded. When ``torsion_extras='auto'``, see
:func:`recommend_torsion_extras` (charged → raw extras; bulky long-chain
→ anti-bias; bulky few-rotor → off; medium neutrals → MMFF-refined).
Args:
smile: smiles code
wps: list of wps
N_iter: number of ETKDG seeds
N_conf: maximum number of FF-optimized conformers
tol: RMSD prune threshold for EmbedMultipleConfs / dedupe
use_uff: whether to use UFF for force field optimization
torsion_extras: ``True``/``False``/``'auto'``/``'on'``/``'off'``, or a
policy dict from :func:`recommend_torsion_extras`
n_extra: max extras to keep (default scales with rotatable-bond count)
grid_step: torsion grid spacing in degrees (default 90)
verbose: print the torsion-extras policy decision
Returns:
a list of pyxtal molecules
"""
from rdkit import Chem
from rdkit.Chem import AllChem
torsionlist = find_rotor_from_smile(smile)
Num = 1
if len(torsionlist) == 0:
if has_non_aromatic_ring(smile):
Num = 10
else:
Num = len(torsionlist)
charged = _is_charged_smiles(smile)
def get_conformers(smile, seed):
mol = Chem.MolFromSmiles(smile)
mol = Chem.AddHs(mol)
ps = AllChem.ETKDGv3()
ps.randomSeed = seed
ps.pruneRmsThresh = tol
if charged:
ps.useRandomCoords = True
AllChem.EmbedMultipleConfs(mol, max([4, Num]), ps)
return mol
m0 = pyxtal_molecule(smile + ".smi", fix=True)
_, valid = m0.get_orientations_in_wps(wps)
mols = []
if valid:
# print('torsion', m0.get_torsion_angles())
mols.append(m0)
done = False
for i in range(N_iter):
mol = get_conformers(smile, seed=i)
if use_uff:
res = AllChem.UFFOptimizeMoleculeConfs(mol)
else:
res = AllChem.MMFFOptimizeMoleculeConfs(mol)
for id, conf in enumerate(mol.GetConformers()):
m = m0.copy()
xyz = m.align(conf)
m.reset_positions(xyz)
try:
m.get_symmetry(symmetrize=True)
except Exception:
# Some pymatgen PointGroupAnalyzer paths can fail for edge cases.
# Keep the conformer and continue with unsymmetrized coordinates.
try:
m.get_symmetry(symmetrize=False)
except Exception:
pass
if isinstance(res, list) and id < len(res):
m.energy = res[id][1]
_, valid = m.get_orientations_in_wps(wps)
add = bool(valid)
if add:
match = False
for mol_ref in mols:
rms, _ = mol_ref.get_rmsd2(xyz, mol_ref.mol.cart_coords)
# print("rms", mol.get_torsion_angles(), rms)
if rms < tol:
match = True
break
if not match:
# print(len(mols)+1, m.get_torsion_angles(xyz))
mols.append(m)
if len(mols) >= N_conf:
done = True
break
if done:
break
# Resolve extras policy
if isinstance(torsion_extras, dict):
policy = torsion_extras
elif torsion_extras in (True, "on", "True", "true", 1):
policy = dict(
use=True,
keep_raw=charged,
refine_mmff=not charged,
mode="grid",
reason="forced on",
)
elif torsion_extras in (False, "off", "False", "false", 0, None):
policy = dict(
use=False, keep_raw=False, refine_mmff=False, mode="off", reason="forced off"
)
else:
# 'auto' or unrecognized → recommend
policy = recommend_torsion_extras(smile, n_tor=len(torsionlist))
if verbose:
print(f" torsion_extras policy: {policy['reason']}")
if policy.get("use") and torsionlist:
mode = policy.get("mode", "grid")
if n_extra is None:
n_extra = _default_n_extra(len(torsionlist), charged, mode=mode)
if mode == "anti_bias":
_append_anti_bias_extras(
mols,
m0,
torsionlist,
wps=wps,
n_extra=n_extra,
dedupe_tol=min(tol, 0.35),
seed0=99,
refine_mmff=policy.get("refine_mmff", False),
)
elif mode == "parent_flip":
_append_parent_flip_extras(
mols,
m0,
torsionlist,
wps=wps,
n_extra=n_extra,
dedupe_tol=min(tol, 0.35),
seed0=101,
refine_mmff=policy.get("refine_mmff", False),
)
elif mode == "mixed_chain":
_append_mixed_chain_extras(
mols,
m0,
torsionlist,
wps=wps,
n_extra=n_extra,
dedupe_tol=min(tol, 0.35),
seed0=99,
refine_mmff=policy.get("refine_mmff", False),
)
else:
_append_torsion_extras(
mols,
m0,
smile,
torsionlist,
wps=wps,
n_extra=n_extra,
grid_step=grid_step,
dedupe_tol=min(tol, 0.35),
max_grid=400 if len(torsionlist) >= 6 else 300,
seed0=99,
keep_raw=policy.get("keep_raw", charged),
refine_mmff=policy.get("refine_mmff", False),
)
# for m in mols:
# print(m.energy, m.pga.sch_symbol, len(torsionlist))
return mols
[docs]
class pyxtal_molecule:
"""
A molecule class to support the descriptin of molecules in a xtal
Features:
- Parse the input from different formats (SMILES, xyz, gjf, etc.).
- Estimate molecular properties such as volume, tolerance, and radii.
- Find and store symmetry information of the molecule.
- Get the principal axis of the molecule.
- Re-align the molecule to center it at (0, 0, 0).
SMILES Format:
If a SMILES format is used, the molecular center is defined following
RDKit's handling of molecular transformations:
https://www.rdkit.org/docs/source/rdkit.Chem.rdMolTransforms.html
Otherwise, the center is just the mean of atomic positions
Args:
mol (str or pymatgen.Molecule): The molecule representation, either as a string
(SMILES or filename) or as a pymatgen `Molecule` object.
tm (Tol_matrix, optional): A tolerance matrix object, used for bond checking.
symmetrize (bool, optional): Whether to symmetrize the molecule by point group.
fix (bool, optional): Fix torsions in the molecule.
torsions (list, optional): List of torsions to analyze or fix.
seed (int, optional): Random seed for internal processes.
random_state (int or numpy.Generator, optional): state for random seed.
symtol (float, optional): Symmetry tolerance. Default is 0.3.
active_sites (list, optional): List of active sites within the molecule.
use_uff (bool, optional): Use UFF for force field. Default is False.
"""
[docs]
def list_molecules():
"""
list the internally supported molecules
"""
molecule_collection.show_names()
def __init__(
self,
mol=None,
symmetrize=True,
fix=False,
torsions=None,
seed=None,
random_state=None,
tm=Tol_matrix(prototype="molecular"),
symtol=0.3,
active_sites=None,
use_uff=False,
):
mo = None
self.smile = None
self.torsionlist = [] #None
self.reflect = False
if seed is None:
seed = 0xF00D
self.seed = seed
self.use_uff = use_uff
# Active sites is a two list of tuples [(donors), (acceptors)]
self.active_sites = active_sites
if isinstance(random_state, Generator):
self.random_state = random_state.spawn(1)[0]
else:
self.random_state = np.random.default_rng(random_state)
# Parse molecules: either file or molecule name
if isinstance(mol, str):
parts = mol.rsplit(".", 1)
self.name = parts[0]
if len(parts) > 1:
# Load the molecule from the given file
ext = parts[-1]
if ext in ["xyz", "gjf", "g03", "json"]:
if os.path.exists(mol):
mo = Molecule.from_file(mol)
else:
raise NameError(f"{mol:s} is not a valid path")
elif ext == "smi":
# Keep the full SMILES body even when it contains '.'
self.smile = parts[0]
# force the use of UFF for SMILES containing P or p
if 'P' in self.smile or 'p' in self.smile:
self.use_uff = True
res = self.rdkit_mol_init(self.smile, fix, torsions)
(symbols, xyz, self.torsionlist) = res
mo = Molecule(symbols, xyz)
symmetrize = False
else:
raise NameError(f"{ext:s} is not a supported format")
else:
# print('\nLoad the molecule {:s} from collections'.format(mol))
mo = molecule_collection[mol]
elif hasattr(mol, "sites"): # pymatgen molecule
self.name = str(mol.formula)
mo = mol
if mo is None:
msg = f"Could not create molecules from given input: {mol:s}"
raise NameError(msg)
# Molecule and symmetry analysis
self.props = mo.site_properties
if len(mo) > 1 and symmetrize:
try:
pga = PointGroupAnalyzer(mo, symtol)
mo = pga.symmetrize_molecule()["sym_mol"]
except:
print(
"Warning: Problem in parsing molecular symmetry with symtol=",
symtol,
)
print("Proceed with no symmetrization")
self.mol = mo
self.get_symmetry()
# Additional molecular properties
self.tm = tm
self.box = self.get_box()
self.volume = self.box.volume
self.get_symbols()
self.get_radius()
self.tols_matrix = self.get_tols_matrix()
xyz = self.mol.cart_coords
self.reset_positions(xyz - self.get_center(xyz))
if self.smile is not None and self.smile not in single_smiles:
# print(self.smile)
ori, _, self.reflect = self.get_orientation(xyz)
def __str__(self):
return "[" + self.name + "]"
[docs]
def save_str(self):
"""
save the object as a dictionary
"""
return self.mol.to(fmt="xyz")
[docs]
@classmethod
def load_str(cls, string):
"""
load the molecule from a dictionary
"""
mol = Molecule.from_str(string, fmt="xyz")
return cls(mol)
[docs]
def copy(self):
"""
simply copy the structure
"""
return deepcopy(self)
[docs]
def swap_axis(self, ax):
"""
swap the molecular axis
"""
coords = self.mol.cart_coords[:, ax]
mo = Molecule(self.symbols, coords)
return pyxtal_molecule(mo, self.tm)
[docs]
def get_box(self, padding=None):
"""
Given a molecule, find a minimum orthorhombic box containing it.
Size is calculated using min and max x, y, and z values,
plus the padding defined by the vdw radius
For best results, call oriented_molecule first.
Args:
padding: float (default is 3.4 according to the vdw radius of C)
Returns:
box: a Box object
"""
mol, P = reoriented_molecule(self.mol)
xyz = mol.cart_coords
dims = [0, 0, 0]
for i in range(3):
dims[i] = np.max(xyz[:, i]) - np.min(xyz[:, i])
if padding is not None:
dims[i] += padding
dims[i] = max([dims[i], 2.0]) # for planar molecules
else:
ids = np.argsort(xyz[:, i])
r = Element(mol[ids[0]].species_string).vdw_radius
r += Element(mol[ids[-1]].species_string).vdw_radius
dims[i] = max([dims[i] + r, 3.4]) # for planar molecules
return Box(dims)
[docs]
def get_lengths(self):
if not hasattr(self, "box"):
self.box = self.get_box()
return self.box.width, self.box.height, self.box.length
[docs]
def get_max_length(self):
w, h, l = self.get_lengths()
return max([w, h, l])
[docs]
def get_box_coordinates(self, xyz, padding=0, resolution=1.0):
"""
Create points cloud to describe the molecular box.
Args:
xyz (ndarray): Coordinates of the molecule
padding (float, optional): Padding distance around the box. Default is 0.
resolution (float): Grid resolution in angstroms. Default is 1.0.
Returns:
tuple:
- cell (ndarray): Box axis vectors
- vertices (ndarray): [N,3] array of box vertices in Cartesian coordinates
- center (ndarray): Box center coordinates
"""
cell = self.get_principle_axes(xyz).T
center = self.get_center(xyz) # , geometry=True)
box = self.get_box(padding)
# print(box)
w, h, l = box.width, box.height, box.length
cell[0, :] *= l
cell[1, :] *= w
cell[2, :] *= h
x_ = np.linspace(-1 / 2, 1 / 2, int(l / resolution) + 1)
y_ = np.linspace(-1 / 2, 1 / 2, int(w / resolution) + 1)
z_ = np.linspace(-1 / 2, 1 / 2, int(h / resolution) + 1)
# XY
# print(len(x_), len(y_), len(z_))
x, y = np.meshgrid(x_, y_, indexing="ij")
size = len(x.flatten())
xy = np.zeros([size * 2, 3])
xy[:size, 0] = x.flatten()
xy[size:, 0] = x.flatten()
xy[:size, 1] = y.flatten()
xy[size:, 1] = y.flatten()
xy[:size, 2] = -0.5
xy[size:, 2] = 0.5
# print(xy.shape)
# print(xy)
y, z = np.meshgrid(y_, z_, indexing="ij")
size = len(y.flatten())
yz = np.zeros([size * 2, 3])
yz[:size, 1] = y.flatten()
yz[size:, 1] = y.flatten()
yz[:size, 2] = z.flatten()
yz[size:, 2] = z.flatten()
yz[:size, 0] = -0.5
yz[size:, 0] = 0.5
x, z = np.meshgrid(x_, z_, indexing="ij")
size = len(z.flatten())
xz = np.zeros([size * 2, 3])
xz[:size, 0] = x.flatten()
xz[size:, 0] = x.flatten()
xz[:size, 2] = z.flatten()
xz[size:, 2] = z.flatten()
xz[:size, 1] = -0.5
xz[size:, 1] = 0.5
vertices = np.zeros([len(xy) + len(yz) + len(xz), 3])
vertices[: len(xy), :] = xy
vertices[len(xy) : len(xy) + len(yz), :] = yz
vertices[len(xy) + len(yz) :, :] = xz
vertices = vertices.dot(cell)
vertices += center
return cell, vertices, center
[docs]
def get_radius(self):
"""
get the radius of a molecule
"""
r_max = 0
for coord, number in zip(self.mol.cart_coords, self.mol.atomic_numbers):
radius = np.linalg.norm(coord) + 0.5 * self.tm.get_tol(number, number)
if radius > r_max:
r_max = radius
self.radius = r_max
# reestimate the radius if it has stick shape
rmax = max([self.box.width, self.box.height, self.box.length])
rmin = min([self.box.width, self.box.height, self.box.length])
if rmax / rmin > 3 and rmax > 12:
self.radius = rmin
[docs]
def get_symbols(self):
self.symbols = [specie.name for specie in self.mol.species]
[docs]
def get_tols_matrix(self, mol2=None, tm=None):
"""
Compute the 2D tolerance matrix between the current and other molecules
Args:
mol2: the 2nd pyxtal_molecule object
tm: tolerance class
Returns:
a 2D matrix which is used internally for distance checking.
"""
if tm is None:
tm = self.tm
numbers1 = self.mol.atomic_numbers
numbers2 = self.mol.atomic_numbers if mol2 is None else mol2.mol.atomic_numbers
tols = np.zeros((len(numbers1), len(numbers2)))
for i1, number1 in enumerate(numbers1):
for i2, number2 in enumerate(numbers2):
tols[i1, i2] = tm.get_tol(number1, number2)
# allow hydrogen bond
if [number1, number2] in [
[1, 7],
[1, 8],
[1, 9],
[7, 1],
[8, 1],
[9, 1],
]:
tols[i1, i2] *= 0.9
if len(self.mol) == 1:
tols *= 0.8 # if only one atom, reduce the tolerance
return tols
[docs]
def set_labels(self):
"""
Set atom labels for the given molecule for H-bond caculation.
Needs to identify the following:
- (O)N-H
- acid-O
- amide-O
- alcohol-O
- N with NH2
- N with NH
"""
def search_H(pairs, ref, pos_H):
"""
Quick routine to search for the id of H that is bonded to N/O:
Args:
pairs: list of atomic pairs
ref: reference id for O or N
pos_H: the starting position for H
"""
res = []
for p in pairs:
if ref in p and max(p) >= pos_H:
res.append(max(p))
return res
if len(self.mol) > 1:
from rdkit import Chem
# template
acid1 = Chem.MolFromSmarts("[C,c]C(=O)O") # COOH
acid2 = Chem.MolFromSmarts("[CH](=O)O") # COOH
amide1 = Chem.MolFromSmarts("[C,c]C(=O)N") # CONH
amide2 = Chem.MolFromSmarts("[CH](=O)N") # CONH
alcohol = Chem.MolFromSmarts("[c,CX3][OH]") # ROH
# alcohol2 = Chem.MolFromSmarts('c[OH]') #ROH
Chem.MolFromSmarts("c") # Aromatic
NH1 = Chem.MolFromSmarts("[NH1]") # NH1
NH2 = Chem.MolFromSmarts("[NH2]") # NH2
# Initialize mol
m = Chem.MolFromSmiles(self.smile)
pos_H = m.GetNumAtoms() # starting position for H
m = Chem.AddHs(m)
labels = [a.GetSymbol() for a in m.GetAtoms()]
# Create bonds
bonds = m.GetBonds()
pairs = np.zeros([len(bonds), 2], dtype=int)
for i, bond in enumerate(bonds):
pairs[i, 0] = bond.GetBeginAtomIdx()
pairs[i, 1] = bond.GetEndAtomIdx()
# Assign aromatic
# ds = m.GetSubstructMatches(aromatic_carbon)
# for d in ds: labels[d[0]] += '_aromatic'
# Assign O
N_O = labels.count("O")
if N_O > 0:
count_O = 0
for i, smart in enumerate([acid1, acid2, amide1, amide2, alcohol]):
ds = m.GetSubstructMatches(smart)
# print(i, ds)
for d in ds:
if i in [0, 1]: # COOH or COO in general
if i == 0:
labels[d[2]] += "_acid"
id = 3
# labels[d[3]] += '_acid'
else:
id = 2
labels[d[1]] += "_acid"
Hs = search_H(pairs, d[id], pos_H)
if len(Hs) > 0:
labels[Hs[0]] += "_O"
count_O += 2
elif i in [2, 3]: # CONH
id = 3 if i == 2 else 2
labels[d[id - 1]] += "_amide"
count_O += 1
else: # OH
labels[d[-1]] += "_alcohol"
labels[search_H(pairs, d[-1], pos_H)[0]] += "_O"
count_O += 1
if count_O == N_O:
# print(i, count_O, 'break')
break
# Assign N
N_N = labels.count("N")
if N_N > 0:
count_N = 0
for i, smart in enumerate([NH1, NH2]):
ds = m.GetSubstructMatches(smart)
for d in ds:
if i == 0:
labels[d[0]] += "_H1" # N_H2
labels[search_H(pairs, d[0], pos_H)[0]] += "_N"
else:
labels[d[0]] += "_H2" # N_H2
Hs = search_H(pairs, d[0], pos_H)
labels[Hs[0]] += "_N"
labels[Hs[1]] += "_N"
count_N += 1
if count_N == N_N:
break
else:
labels = self.symbols
print(labels)
self.labels = labels
[docs]
def get_coefs_matrix(self, mol2=None, ignore_error=True):
"""
Get the Atom-Atom potential parameters between two molecules.
Calculates coefficients A, B, C for the potential energy equation:
E = A*exp(-B*R) - C*R^(-6)
Parameters are from Gavezotti, Acc. Chem. Res., 27, 1994.
Args:
mol2 (pyxtal_molecule, optional): Second molecule to calculate interaction with.
If None, uses same molecule.
ignore_error (bool): Whether to ignore errors for unsupported atoms.
Defaults to True.
Returns:
ndarray: Array of shape (n_atoms1, n_atoms2, 3) containing A, B, C
coefficients for each atom pair. These are used to compute the
intermolecular energy. Units are Kcal/mol and angstrom.
"""
labels1 = self.labels if hasattr(self, "labels") else self.symbols
numbers1 = self.mol.atomic_numbers
if mol2 is None:
numbers2 = self.mol.atomic_numbers
labels2 = labels1
else:
numbers2 = mol2.mol.atomic_numbers
labels2 = mol2.labels if hasattr(mol2, "labels") else mol2.symbols
coefs = np.zeros([len(numbers1), len(numbers2), 3])
for i1, n1 in enumerate(numbers1):
for i2, n2 in enumerate(numbers2):
if [n1, n2] in [[1, 1]]: # H-H
coefs[i1, i2, :] = [5774, 4.01, 26.1]
elif [n1, n2] in [[1, 6], [6, 1]]: # H-C
coefs[i1, i2, :] = [28870, 4.10, 113.0]
elif [n1, n2] in [[1, 7]]: # H-N
if len(labels1[i1]) > 1:
if labels1[i1] == "H_N1": # HB-N(-NH-N):
coefs[i1, i2, :] = [7215600, 7.78, 476]
else: # HB-N(-NH2-N):
coefs[i1, i2, :] = 1803920, 7.37, 165
else:
coefs[i1, i2, :] = [54560, 4.52, 120.0]
elif [n1, n2] in [[7, 1]]: # N-H
if len(labels2[i2]) > 1:
if labels2[i2] == "H_N1": # HB-N(-NH-N):
coefs[i1, i2, :] = [7215600, 7.78, 476]
else: # HB-N(-NH2-N):
coefs[i1, i2, :] = 1803920, 7.37, 165
else:
coefs[i1, i2, :] = [54560, 4.52, 120.0]
elif [n1, n2] in [[1, 8]]: # H-O
if len(labels1[i1]) > 1:
if labels2[i2] == "O_amide": # HB...O=C-N
coefs[i1, i2, :] = [3607810, 7.78, 238]
elif labels2[i2] == "O_acid": # HB...O=C-OH
coefs[i1, i2, :] = [6313670, 8.75, 205]
elif labels2[i2] == "O_alcohol": # HB...OH
coefs[i1, i2, :] = [4509750, 7.78, 298]
else:
# print("Oxygen label problem", labels2[i2]); import sys; sys.exit()
coefs[i1, i2, :] = [70610, 4.82, 105.0]
else: # Normal cases:
coefs[i1, i2, :] = [70610, 4.82, 105.0]
elif [n1, n2] in [[8, 1]]: # O-H
if len(labels2[i2]) > 1:
if labels1[i1] == "O_amide": # HB...O=C-N
coefs[i1, i2, :] = [3607810, 7.78, 238]
elif labels1[i1] == "O_acid": # HB...O=C-OH
coefs[i1, i2, :] = [6313670, 8.75, 205]
elif labels1[i1] == "O_alcohol": # HB...OH
coefs[i1, i2, :] = [4509750, 7.78, 298]
else:
# print('Oxygen label problem', labels2[i1]); import sys; sys.exit()
coefs[i1, i2, :] = [70610, 4.82, 105.0]
else: # Normal cases:
coefs[i1, i2, :] = [70610, 4.82, 105.0]
elif [n1, n2] in [[1, 16], [16, 1]]: # H-S
coefs[i1, i2, :] = [64190, 4.03, 279.0]
elif [n1, n2] in [[1, 17], [17, 1]]: # H-Cl
coefs[i1, i2, :] = [70020, 4.09, 279.0]
elif [n1, n2] in [[6, 6]]: # C-C
coefs[i1, i2, :] = [54050, 3.47, 578.0]
elif [n1, n2] in [[6, 7], [7, 6]]: # C-N
coefs[i1, i2, :] = [117470, 3.86, 667.0]
elif [n1, n2] in [[6, 8], [8, 6]]: # C-O
coefs[i1, i2, :] = [93950, 3.74, 641.0]
elif [n1, n2] in [[6, 16], [16, 6]]: # C-S
coefs[i1, i2, :] = [126460, 3.41, 1504.0]
elif [n1, n2] in [[6, 17], [17, 6]]: # C-Cl
coefs[i1, i2, :] = [93370, 3.52, 923.0]
elif [n1, n2] in [[7, 7]]: # N-N
coefs[i1, i2, :] = [87300, 3.65, 691.0]
elif [n1, n2] in [[7, 8], [8, 7]]: # N-O
coefs[i1, i2, :] = [64190, 3.86, 364.0]
elif [n1, n2] in [[7, 16], [16, 7], [7, 17], [17, 7]]: # N-S/Cl
coefs[i1, i2, :] = [0, 3.65, 0]
elif [n1, n2] in [[8, 8]]: # O-O
if False: # labels1[i1] == 'O_alcohol' and labels2[i2] == 'O_alcohol':
coefs[i1, i2, :] = [3607800, 5.00, 3372.0]
else:
coefs[i1, i2, :] = [46680, 3.74, 319.0]
elif [n1, n2] in [[8, 16], [16, 8]]: # O-S
coefs[i1, i2, :] = [110160, 3.63, 906.0]
elif [n1, n2] in [[8, 17], [17, 8]]: # O-Cl
coefs[i1, i2, :] = [80855, 3.63, 665.0]
elif [n1, n2] in [[16, 16]]: # S-S
coefs[i1, i2, :] = [259960, 3.52, 2571]
elif [n1, n2] in [[16, 17], [17, 16]]: # S-Cl
coefs[i1, i2, :] = [1800000, 3.52, 2000] # made
elif [n1, n2] in [[17, 17]]: # Cl-Cl
coefs[i1, i2, :] = [140050, 3.52, 1385]
else:
if ignore_error:
coefs[i1, i2, :] = [0.0, 0.0, 0.0]
else:
msg = f"atom type is not supported: {n1:d} {n2:d}"
raise AtomTypeError(msg)
# return None
return coefs
[docs]
def show(self):
"""
show the molecule
"""
from pyxtal.viz import display_molecules
return display_molecules([self.mol])
[docs]
def show_box(self):
"""
Show the molecule.
"""
from pyxtal.viz import display_molecules
return display_molecules(self.mol)
[docs]
def rdkit_mol(self, N_confs=1):
"""
Initialize the mol xyz and torsion list
"""
from rdkit import Chem
mol = Chem.MolFromMolBlock(self.rdkit_mb, removeHs=False)
if N_confs > 1:
conf = mol.GetConformer(0)
for _i in range(N_confs - 1):
mol.AddConformer(conf, True)
return mol
[docs]
def rdkit_mol_init(self, smile, fix, torsions):
"""
Initialize the mol xyz and torsion list
Args:
smile: smile string
fix: whether or not fix the seed
torsions: None or list
"""
from rdkit import Chem
from rdkit.Chem import AllChem
if smile not in single_smiles: # ["Cl-", "F-", "Br-", "I-", "Li+", "Na+"]:
torsionlist = find_rotor_from_smile(smile)
mol = Chem.MolFromSmiles(smile)
mol = Chem.AddHs(mol)
symbols = []
for id in range(mol.GetNumAtoms()):
symbols.append(mol.GetAtomWithIdx(id).GetSymbol())
if len(smile) > 100: # a tmp fix for KEKULN10
AllChem.EmbedMultipleConfs(mol, numConfs=1, randomSeed=3)
cid = 0
else:
ps = AllChem.ETKDGv3()
ps.randomSeed = self.seed
AllChem.EmbedMultipleConfs(mol, 1, ps)
if mol.GetNumConformers() == 0:
AllChem.EmbedMultipleConfs(mol, 3, ps)
if self.use_uff:
res = AllChem.UFFOptimizeMoleculeConfs(mol)
else:
res = AllChem.MMFFOptimizeMoleculeConfs(mol)
engs = [c[1] for c in res]
cid = engs.index(min(engs))
self.rdkit_mb = Chem.MolToMolBlock(mol)
self.energy = engs[cid]
ref_conf = mol.GetConformer(cid) # always the reference molecule
if fix or torsions is not None or len(torsionlist) == 0:
conf = ref_conf
else:
randomSeed = -1 if self.random_state is None else 1
AllChem.EmbedMultipleConfs(
mol,
numConfs=max([1, 4 * len(torsionlist)]),
maxAttempts=200,
useRandomCoords=True,
pruneRmsThresh=0.5,
randomSeed=randomSeed,
)
N_confs = mol.GetNumConformers()
conf_id = int(self.random_state.choice(range(N_confs)))
conf = mol.GetConformer(conf_id)
# xyz = conf.GetPositions()
# res = AllChem.MMFFOptimizeMoleculeConfs(mol)
# print("Eng", res[conf_id])
# set tosion angles from random or pre-defined values
if torsions is not None:
xyz = self.set_torsion_angles(conf, torsions, torsionlist=torsionlist)
else:
xyz = conf.GetPositions()
xyz -= self.get_center(xyz)
else:
# single atom cation or anions
pattern = r"[A-Za-z]+(?=[+\-]?[^A-Za-z]|$)"
matches = re.findall(pattern, smile)
if matches:
symbols = [matches[0]] # ["Cl"]
else:
raise ValueError("the input smiles cannot be analyzed", smile)
xyz = np.zeros([1, 3])
torsionlist = []
return symbols, xyz, torsionlist
[docs]
def perturb_torsion(self, xyz):
"""
slightly perturb the torsion
"""
angs = self.get_torsion_angles(xyz, self.torsionlist)
angs *= 1 + 0.1 * self.random_state.uniform(-1.0, 1.0, len(angs))
xyz = self.set_torsion_angles(conf, angs, torsionlist=self.torsionlist)
xyz -= self.get_center(xyz)
return xyz
[docs]
def align(self, conf, reflect=False, torsionlist=None):
"""
Align the molecule and return the xyz
The default CanonicalizeConformer function may also include inversion
"""
from rdkit.Chem import rdMolTransforms as rdmt
# Rotation
if len(self.smile) > 1:
trans = rdmt.ComputeCanonicalTransform(conf)
if abs(abs(np.linalg.det(trans)) - 1.0) > 1e-1:
print("Bug in trans", np.linalg.det(trans))
import sys
sys.exit()
elif np.linalg.det(trans[:3, :3]) < 0:
trans[:3, :3] *= -1
# add reflection if needed
if reflect:
trans[:3, :3] *= -1
rdmt.TransformConformer(conf, trans)
# Translation
pt = rdmt.ComputeCentroid(conf)
center = np.array([pt.x, pt.y, pt.z])
xyz = conf.GetPositions() - center
# adjust cases like H2O
if len(self.smile) == 1:
xyz -= np.mean(xyz, axis=0)
A = get_inertia_tensor(xyz)
P = np.linalg.eigh(A)[1]
if np.linalg.det(P) < 0:
P[0] *= -1
xyz = np.dot(xyz, P)
return xyz
[docs]
def get_center(self, xyz, geometry=False):
"""
get the molecular center for a transformed xyz
"""
if geometry or self.smile is None:
return np.mean(xyz, axis=0)
else:
if self.smile in [
"Cl-",
"F-",
"Br-",
"I-",
"Li+",
"Na+",
"[Cl-]",
"[F-]",
"[Br-]",
"[I-]",
"[Li+]",
"[Na+]",
]:
return xyz[0]
else:
if len(self.smile) == 1:
# return xyz[0]
return np.mean(xyz, axis=0)
else:
# from rdkit
from rdkit.Chem import rdMolTransforms as rdmt
from rdkit.Geometry import Point3D
conf = self.rdkit_mol().GetConformer(0)
for i in range(len(xyz)):
x, y, z = xyz[i]
conf.SetAtomPosition(i, Point3D(x, y, z))
pt = rdmt.ComputeCentroid(conf)
return np.array([pt.x, pt.y, pt.z])
[docs]
def get_principle_axes(self, xyz, rdmt=True):
"""
Get the principle axis for a rotated xyz, sorted by the moments.
"""
if self.smile is None or len(self.smile) == 1 or not rdmt:
Inertia = get_inertia_tensor(xyz)
_, matrix = np.linalg.eigh(Inertia)
return matrix
else:
from rdkit.Chem import rdMolTransforms as rdmt
from rdkit.Geometry import Point3D
conf1 = self.rdkit_mol().GetConformer(0)
for i in range(len(self.mol)):
x, y, z = xyz[i]
conf1.SetAtomPosition(i, Point3D(x, y, z))
return rdmt.ComputePrincipalAxesAndMoments(conf1)[0]
[docs]
def get_torsion_angles(self, xyz=None, torsionlist=None):
"""
Get the torsion angles for the molecule.
Args:
xyz (ndarray, optional): Coordinates to compute angles for.
If None, uses current molecular coordinates.
torsionlist (list, optional): List of torsion definitions.
If None, uses molecule's torsionlist.
Returns:
list: List of torsion angles in degrees.
Returns empty list if no torsions defined.
"""
if xyz is None:
xyz = self.mol.cart_coords
if torsionlist is None:
torsionlist = self.torsionlist
angs = []
if len(torsionlist) > 0:
from rdkit.Chem import rdMolTransforms as rdmt
from rdkit.Geometry import Point3D
conf = self.rdkit_mol().GetConformer(0)
for i in range(len(xyz)):
x, y, z = xyz[i]
conf.SetAtomPosition(i, Point3D(x, y, z))
for torsion in torsionlist:
(i, j, k, l) = torsion
angs.append(rdmt.GetDihedralDeg(conf, i, j, k, l))
return angs
[docs]
def set_torsion_angles(self, conf, angles, reflect=False, torsionlist=None):
"""
Reset the torsion angles and update molecular xyz
"""
from rdkit.Chem import rdMolTransforms as rdmt
if torsionlist is None:
torsionlist = self.torsionlist
for id, torsion in enumerate(torsionlist):
(i, j, k, l) = torsion
rdmt.SetDihedralDeg(conf, i, j, k, l, angles[id])
return self.align(conf, reflect)
[docs]
def relax(self, xyz, align=False):
"""
Relax the input xyz coordinates with rdit MMFF
Args:
xyz: 3D coordinates
align: whether or not align the xyz
Returns:
xyz: new xyz
eng: energy value
"""
from rdkit.Chem import AllChem
from rdkit.Geometry import Point3D
mol = self.rdkit_mol(1)
conf0 = mol.GetConformer(0)
# reset the xyz
for i in range(len(self.mol)):
x, y, z = xyz[i]
conf0.SetAtomPosition(i, Point3D(x, y, z))
if self.use_uff:
res = AllChem.UFFOptimizeMoleculeConfs(mol)
else:
res = AllChem.MMFFOptimizeMoleculeConfs(mol)
xyz = self.align(conf0) if align else mol.GetConformer(0).GetPositions()
return xyz, res[0][1]
[docs]
def get_rmsd2(self, xyz0, xyz1):
"""
Compute the rmsd with another 3D xyz coordinates.
Args:
xyz0 (ndarray): First set of atomic coordinates
xyz1 (ndarray): Second set of atomic coordinates
Returns:
tuple:
- rmsd (float): Root mean square deviation between the coordinates
- trans (ndarray): 4x4 transformation matrix that maps xyz0 onto xyz1
"""
from rdkit.Chem import RemoveHs, rdMolAlign
from rdkit.Geometry import Point3D
mol = self.rdkit_mol(3)
conf0 = mol.GetConformer(0)
conf1 = mol.GetConformer(1)
for i in range(len(self.mol)):
x0, y0, z0 = xyz0[i]
x1, y1, z1 = xyz1[i]
conf0.SetAtomPosition(i, Point3D(x0, y0, z0))
conf1.SetAtomPosition(i, Point3D(x1, y1, z1))
mol = RemoveHs(mol)
rmsd, trans = rdMolAlign.GetAlignmentTransform(mol, mol, 1, 0)
return rmsd, trans
[docs]
def get_rmsd(self, xyz, debug=False):
"""
Compute the rmsd with another 3D xyz coordinates
Args:
xyz: 3D coordinates
Returns:
rmsd (float): rmsd values
transition matrix: 4*4 matrix
match: True or False
"""
from rdkit.Chem import RemoveHs, rdMolAlign
from rdkit.Geometry import Point3D
mol = self.rdkit_mol(3)
# 3 conformers for comparison
conf0 = mol.GetConformer(0)
conf1 = mol.GetConformer(1) # reference+reflection
conf2 = mol.GetConformer(2) # trial xyz
angs = self.get_torsion_angles(xyz)
xyz0 = self.set_torsion_angles(conf0, angs) # conf0 with aligned
xyz1 = self.set_torsion_angles(conf0, angs, True) # conf0 with aligned+reflect
# print('xyz0', xyz0)
# reset the xyz
for i in range(len(self.mol)):
x0, y0, z0 = xyz0[i]
x1, y1, z1 = xyz1[i]
x, y, z = xyz[i]
conf0.SetAtomPosition(i, Point3D(x0, y0, z0))
conf1.SetAtomPosition(i, Point3D(x1, y1, z1))
conf2.SetAtomPosition(i, Point3D(x, y, z))
mol = RemoveHs(mol)
rmsd1, trans1 = rdMolAlign.GetAlignmentTransform(mol, mol, 2, 0)
rmsd2, trans2 = rdMolAlign.GetAlignmentTransform(mol, mol, 2, 1)
if debug:
from rdkit.Chem import rdmolfiles
rdmolfiles.MolToXYZFile(mol, "1.xyz", 0)
rdmolfiles.MolToXYZFile(mol, "2.xyz", 1)
rdmolfiles.MolToXYZFile(mol, "3.xyz", 2)
print(rmsd1, rmsd2)
if rmsd1 <= rmsd2:
# return rmsd1, trans1, True
return rmsd1, trans1, False
else:
# return rmsd2, trans2, False
return rmsd2, trans2, True
[docs]
def get_orientation(self, xyz, rtol=0.15):
"""
Get the orientation for the given xyz coordinates.
Args:
xyz (ndarray): Molecular coordinates
rtol (float, optional): Relative tolerance. Defaults to 0.15.
Returns:
tuple:
- array: Euler angles in degrees [alpha, beta, gamma]
- float: RMSD from reference orientation
- bool: Whether reflection was applied
"""
xyz -= self.get_center(xyz)
if self.smile is not None and len(self.smile) > 1: # not in ["O", "o"]:
rmsd, trans, reflect = self.get_rmsd(xyz)
tol = rtol * len(xyz)
if rmsd < tol:
trans = trans[:3, :3].T
r = Rotation.from_matrix(trans)
return r.as_euler("zxy", degrees=True), rmsd, reflect
else:
msg = "Problem in conformer\n"
msg += f"{rmsd1:5.2f} {rmsd2:5.2f}\n"
if len(self.torsionlist) > 0:
msg += str(self.get_torsion_angles(xyz)) + "\n"
msg += str(self.get_torsion_angles(xyz0)) + "\n"
msg += str(self.get_torsion_angles(xyz1)) + "\n"
raise ConformerError(msg)
else:
# the orientation of CH4, NH3, H2O
ref = np.array(
[
[-0.00111384, 0.36313718, 0.0],
[-0.82498189, -0.18196256, 0.0],
[0.82609573, -0.18117463, 0.0],
]
)
Inertia = get_inertia_tensor(xyz)
_, matrix = np.linalg.eigh(Inertia)
np.dot(xyz, matrix)
# identify the rotation matrix
libs = np.array(
[
[[1, 1, 1]],
[[-1, 1, 1]],
[[1, -1, 1]],
[[1, 1, -1]],
[[-1, -1, 1]],
[[1, -1, -1]],
[[-1, 1, -1]],
[[-1, -1, -1]],
]
)
dists = np.zeros(8)
for i, lib in enumerate(libs):
matrix0 = matrix * np.repeat(lib, 3, axis=0)
res = np.dot(ref, np.linalg.inv(matrix0))
dists[i] = np.sum((res - xyz[:len(ref)]) ** 2)
# print(i, res)
id = np.argmin(dists)
matrix = matrix * np.repeat(libs[id], 3, axis=0)
try:
r = Rotation.from_matrix(np.linalg.inv(matrix).T)
ang = r.as_euler("zxy", degrees=True)
except:
if len(matrix) == 3:
ang = np.zeros(3)
return ang, 0, False
[docs]
def to_ase(self):
"""
Convert to ase atoms
"""
return self.mol.to_ase_atoms()
[docs]
def reset_positions(self, coors):
"""
reset the coordinates
"""
from pymatgen.core.sites import Site
if len(coors) != len(self.mol._sites):
raise ValueError("number of atoms is inconsistent!")
else:
for i, coor in enumerate(coors):
_site = self.mol._sites[i]
new_site = Site(_site.species, coor, properties=_site.properties)
self.mol._sites[i] = new_site
[docs]
def apply_inversion(self):
"""
reset the coordinates
"""
xyz = self.mol.cart_coords
center = self.get_center(xyz)
xyz -= center
xyz *= -1
self.reset_positions(xyz)
[docs]
def get_symmetry(self, xyz=None, symmetrize=False, rtol=0.30):
"""
Set the molecule's point symmetry.
Sets the following attributes:
- pga: Point group analyzer from pymatgen
- pg: Point group from pyxtal
- symops: List of symmetry operations
Args:
xyz (ndarray, optional): Coordinates to analyze. Defaults to current coordinates.
symmetrize (bool, optional): Whether to symmetrize coordinates. Defaults to False.
rtol (float, optional): Symmetry tolerance. Defaults to 0.30.
"""
mol = deepcopy(self.mol) if xyz is None else Molecule(self.symbols, xyz)
if self.smile is not None:
mol.remove_species("H")
mol._spin_multiplicity = None # don't check spin
if symmetrize:
pga = PointGroupAnalyzer(mol, rtol, eigen_tolerance=1e-3)
mol = pga.symmetrize_molecule()["sym_mol"]
pga = PointGroupAnalyzer(mol, rtol, eigen_tolerance=1e-3)
self.mol_no_h = mol
# print(mol.to(fmt='xyz'), pga.sch_symbol)
# For single atoms, no point group using a list of operations
if len(mol) == 1:
symm_m = []
symbol = "C1"
else:
symbol = pga.sch_symbol
pg = pga.get_pointgroup()
symm_m = list(pg)
if "*" in symbol: # linear molecules
symbol = symbol.replace("*", "6")
# Add 12-fold and reflections in place of ininitesimal rotation
for i, axis in enumerate(np.array([[1, 0, 0], [0, 1, 0], [0, 0, 1]])):
# op = SymmOp.from_rotation_and_translation(aa2matrix(axis, np.pi/6), [0,0,0])
m1 = Rotation.from_rotvec(np.pi / 6 * axis).as_matrix()
op = SymmOp.from_rotation_and_translation(m1, [0, 0, 0])
if pga.is_valid_op(op):
symm_m.append(op)
# Any molecule with infinitesimal symmetry is linear;
# Thus, it possess mirror symmetry for any axis perpendicular
# To the rotational axis. pymatgen does not add this symmetry
# for all linear molecules - for example, hydrogen
if i == 0:
symm_m.append(SymmOp.from_xyz_str("x,-y,z"))
symm_m.append(SymmOp.from_xyz_str("x,y,-z"))
# r = SymmOp.from_xyz_str("-x,y,-z")
elif i == 1:
symm_m.append(SymmOp.from_xyz_str("-x,y,z"))
symm_m.append(SymmOp.from_xyz_str("x,y,-z"))
# r = SymmOp.from_xyz_str("-x,-y,z")
elif i == 2:
symm_m.append(SymmOp.from_xyz_str("-x,y,z"))
symm_m.append(SymmOp.from_xyz_str("x,-y,z"))
# r = SymmOp.from_xyz_str("x,-y,-z")
# Generate a full list of SymmOps for the pointgroup
symm_m = generate_full_symmops(symm_m, 1e-3)
break
self.symops = symm_m
self.pga = pga
if symbol == "S2":
symbol = "Ci"
self.pg = Group(symbol, dim=0)
[docs]
def get_orientations_in_wps(self, wps=None, rtol=1e-2):
"""
Compute the valid orientations from a given Wyckoff site symmetry.
Args:
wp: a pyxtal.symmetry.Wyckoff_position object
Returns:
a list of operations.Orientation objects
"""
if wps is None:
return None, True
else:
valid = False
valid_oris = []
for wp in wps:
allowed = self.get_orientations_in_wp(wp, rtol)
if len(allowed) > 0:
valid = True
valid_oris.append(allowed)
return valid_oris, valid
[docs]
def get_orientations_in_wp(self, wp, rtol=1e-2):
"""
Compute the valid orientations from a given Wyckoff site symmetry.
Args:
wp: a pyxtal.symmetry.Wyckoff_position object
Returns:
a list of pyxtal.molecule.Orientation objects
"""
# For single atoms, there are no constraints
if len(self.mol) == 1 or wp.index == 0:
return [Orientation([[1, 0, 0], [0, 1, 0], [0, 0, 1]], degrees=2, random_state=self.random_state)]
# C1 molecule cannot take specical position
elif wp.index > 1 and self.pga.sch_symbol == "C1":
return []
symm_w = wp.get_site_symm_wo_translation() # symmetry without translation
# molecule has fewer symops
if len(self.pg[0]) < len(symm_w):
return []
symm_m = self.symops
opa_m = []
for op_m in symm_m:
opa = OperationAnalyzer(op_m)
opa_m.append(opa)
# Store OperationAnalyzer objects for each Wyckoff symmetry SymmOp
opa_w = []
for op_w in symm_w:
opa_w.append(OperationAnalyzer(op_w))
"""
Check for constraints from the Wyckoff symmetry. If we find ANY two
constraints (SymmOps with unique axes), the molecule's point group MUST
contain SymmOps which can be aligned to these particular constraints.
However, there may be multiple compatible orientations of the molecule
consistent with these constraints
"""
constraint1 = None
constraint2 = None
for i, op_w in enumerate(symm_w):
if opa_w[i].axis is not None:
constraint1 = opa_w[i]
for j, op_w in enumerate(symm_w):
if opa_w[j].axis is not None:
dot = np.dot(opa_w[i].axis, opa_w[j].axis)
if (not np.isclose(dot, 1, rtol=rtol)) and (not np.isclose(dot, -1, rtol=rtol)):
constraint2 = opa_w[j]
break
break
# Indirectly store the angle between the constraint axes
if constraint1 is not None and constraint2 is not None:
dot_w = np.dot(constraint1.axis, constraint2.axis)
# Generate 1st consistent molecular constraints
constraints_m = []
if constraint1 is not None:
for i, opa1 in enumerate(opa_m):
if opa1.is_conjugate(constraint1):
constraints_m.append([opa1, []])
# Generate 2nd constraint in opposite direction
extra = deepcopy(opa1)
extra.axis = [
opa1.axis[0] * -1,
opa1.axis[1] * -1,
opa1.axis[2] * -1,
]
constraints_m.append([extra, []])
# Remove redundancy for the first constraints
list_i = list(range(len(constraints_m)))
list_j = list(range(len(constraints_m)))
copy = deepcopy(constraints_m)
for i, c1 in enumerate(copy):
if i in list_i:
for j, c2 in enumerate(copy):
if i > j and j in list_j and j in list_i:
# Check if axes are colinear
if np.isclose(np.dot(c1[0].axis, c2[0].axis), 1, rtol=rtol):
list_i.remove(j)
list_j.remove(j)
# Check if axes are symmetrically equivalent
else:
cond1 = False
# cond2 = False
for opa in opa_m:
if opa.type == "rotation":
op = opa.op
if np.isclose(
np.dot(op.operate(c1[0].axis), c2[0].axis),
1,
rtol=5 * rtol,
):
cond1 = True
break
if cond1: # or cond2 is True:
list_i.remove(j)
list_j.remove(j)
c_m = deepcopy(constraints_m)
constraints_m = []
for i in list_i:
constraints_m.append(c_m[i])
# Generate 2nd consistent molecular constraints
valid = list(range(len(constraints_m)))
if constraint2 is not None:
for i, c in enumerate(constraints_m):
opa1 = c[0]
for j, opa2 in enumerate(opa_m):
if opa2.is_conjugate(constraint2):
dot_m = np.dot(opa1.axis, opa2.axis)
# Ensure that the angles are equal
if abs(dot_m - dot_w) < 0.02 or abs(dot_m + dot_w) < 0.02:
constraints_m[i][1].append(opa2)
# Generate 2nd constraint in opposite direction
extra = deepcopy(opa2)
extra.axis = [
opa2.axis[0] * -1,
opa2.axis[1] * -1,
opa2.axis[2] * -1,
]
constraints_m[i][1].append(extra)
# If no consistent constraints are found, remove first constraint
if constraints_m[i][1] == []:
valid.remove(i)
copy = deepcopy(constraints_m)
constraints_m = []
for i in valid:
constraints_m.append(copy[i])
# Generate orientations consistent with the possible constraints
orientations = []
# Loop over molecular constraint sets
for c1 in constraints_m:
v1 = c1[0].axis
v2 = constraint1.axis
T = rotate_vector(v1, v2, random_state=self.random_state)
# If there is only one constraint
if c1[1] == []:
o = Orientation(T, degrees=1, axis=constraint1.axis, random_state=self.random_state)
orientations.append(o)
else:
# Loop over second molecular constraints
for opa in c1[1]:
phi = angle(constraint1.axis, constraint2.axis)
phi2 = angle(constraint1.axis, np.dot(T, opa.axis))
if np.isclose(phi, phi2, rtol=rtol):
r = np.sin(phi)
c = np.linalg.norm(np.dot(T, opa.axis) - constraint2.axis)
theta = np.arccos(1 - (c**2) / (2 * (r**2)))
# R = aa2matrix(constraint1.axis, theta)
R = Rotation.from_rotvec(theta * constraint1.axis).as_matrix()
T2 = np.dot(R, T)
a = angle(np.dot(T2, opa.axis), constraint2.axis)
if not np.isclose(a, 0, rtol=rtol):
T2 = np.dot(np.linalg.inv(R), T)
o = Orientation(T2, degrees=0, random_state=self.random_state)
orientations.append(o)
# Ensure the identity orientation is checked if no constraints are found
if constraints_m == []:
o = Orientation(np.identity(3), degrees=2, random_state=self.random_state)
orientations.append(o)
# Remove redundancy from orientations
list_i = list(range(len(orientations)))
list_j = list(range(len(orientations)))
for i, o1 in enumerate(orientations):
if i in list_i:
for j, o2 in enumerate(orientations):
if i > j and j in list_j and j in list_i:
# m1 = o1.get_matrix(angle=0)
# m2 = o2.get_matrix(angle=0)
m1 = o1.matrix
m2 = o2.matrix
new_op = SymmOp.from_rotation_and_translation(np.dot(m2, np.linalg.inv(m1)), [0, 0, 0])
P = SymmOp.from_rotation_and_translation(np.linalg.inv(m1), [0, 0, 0])
old_op = P * new_op * P.inverse
if self.pga.is_valid_op(old_op):
list_i.remove(j)
list_j.remove(j)
orientations_new = []
for i in list_i:
orientations_new.append(orientations[i])
# Check each of the found orientations for consistency with Wyckoff site.
# If consistent, put into an array of valid orientations
# print("======", orientations_new)
allowed = []
for o in orientations_new:
op = o.get_op()
mo = deepcopy(self.mol_no_h)
mo.apply_operation(op)
# print(mo)
if is_compatible_symmetry(mo, wp):
allowed.append(o)
return allowed
[docs]
def get_energy(self, xyz1, xyz2):
"""
Get packing energy between two neighboring molecules
"""
cdist(xyz1 - xyz2)
[docs]
class Box:
"""
Class for storing the binding box for a molecule.
Args:
dims: [length, width, height]
"""
def __init__(self, dims):
self.length = dims[0] # float(abs(maxy - miny))
self.width = dims[1] # float(abs(maxx - minx))
self.height = dims[2] # float(abs(maxz - minz))
self.volume = self.width * self.length * self.height
def __str__(self):
return f"l: {self.length:6.2f}, w: {self.width:6.2f}, d: {self.height:6.2f}"
[docs]
def operate(self, rot=np.eye(3), center=np.zeros(3)):
"""
Perform operation on the box:
Args:
rot: 3*3 rotation matrix
center: center position
"""
raise NotImplementedError
[docs]
class Orientation:
"""
Stores orientations for molecules based on vector constraints.
Can be stored to regenerate orientations consistent with a given constraint
vector, without re-calling orientation_in_wyckoff_position. Allows for
generating orientations which differ only in their rotation about a given axis.
Args:
matrix (ndarray): A 3x3 rotation matrix describing the orientation
(and/or inversion) to store
degrees (int): The number of degrees of freedom:
- 0: The orientation refers to a single rotation matrix
- 1: The orientation can be rotated about a single axis
- 2: The orientation can be any pure rotation matrix
axis (ndarray, optional): Axis about which the orientation can rotate.
Only used if degrees is equal to 1
random_state (int or Generator, optional): Random number generator state
"""
def __init__(self, matrix=None, degrees=2, axis=None, random_state=None):
self.matrix = np.array(matrix)
self.degrees = degrees
if isinstance(random_state, Generator):
self.random_state = random_state.spawn(1)[0]
else:
self.random_state = np.random.default_rng(random_state)
if degrees == 1:
if axis is None:
raise ValueError("axis is required for orientation")
axis /= np.linalg.norm(axis)
self.axis = axis
self.r = Rotation.from_matrix(self.matrix)
self.angle = None
def __str__(self):
s = "-------PyXtal.molecule.Orientation class----\n"
s += f"degree of freedom: {self.degrees:d}\n"
s += "Rotation matrix:\n"
s += "{:6.3f} {:6.3f} {:6.3f}\n".format(*self.matrix[:, 0])
s += "{:6.3f} {:6.3f} {:6.3f}\n".format(*self.matrix[:, 1])
s += "{:6.3f} {:6.3f} {:6.3f}\n".format(*self.matrix[:, 2])
if self.axis is not None:
s += "Rotation axis\n"
s += "{:6.2f} {:6.2f} {:6.3f}\n".format(*self.axis)
return s
[docs]
def reset_matrix(self, matrix):
self.matrix = matrix
self.r = Rotation.from_matrix(matrix)
def __repr__(self):
return str(self)
[docs]
def copy(self):
new = deepcopy(self)
# deepcopy clones the Generator with identical internal state, so the
# copy would reproduce the exact same random draws. Spawn an
# independent stream to keep copies decorrelated while remaining
# reproducible from the parent seed.
if isinstance(self.random_state, Generator):
new.random_state = self.random_state.spawn(1)[0]
return new
[docs]
def save_dict(self):
return {"matrix": self.matrix, "degrees": self.degrees, "axis": self.axis}
[docs]
@classmethod
def load_dict(cls, dicts):
matrix = dicts["matrix"]
degrees = dicts["degrees"]
axis = dicts["axis"]
return cls(matrix, degrees, axis)
[docs]
def change_orientation(self, angle="random", flip=False, update=True):
"""
Change the orientation of molecule by applying a rotation.
It allows for specification of an angle (or a random angle) to rotate about
the constraint axis. If the system has 2 degrees of rotational freedom,
the molecule can also be flipped with a probability
Args:
angle (float or str, optional): The angle to rotate about the constraint axis.
If "random", a random rotation angle is selected
flip (bool, optional): Whether to apply an random flip. This is only applied
if the system has 2 degrees of rotational freedom.
"""
if self.degrees >= 1:
# Choose the axis
if self.axis is None:
self.set_axis()
# Parse the angle
if angle == "random":
angle = (self.random_state.random() - 1) * np.pi * 2
#self.angle = angle
# Update the matrix
r1 = Rotation.from_rotvec(angle * self.axis)
# Optionally flip the molecule
if self.degrees == 2 and flip and self.random_state.random() > 0.5:
ax = self.random_state.choice(["x", "y", "z"])
angle0 = self.random_state.choice([90, 180, 270])
r2 = Rotation.from_euler(ax, angle0, degrees=True)
r1 = r2 * r1
r = r1 * self.r
matrix = r.as_matrix()
if update:
self.r = r
self.matrix = matrix
return matrix
else:
return self.matrix
[docs]
def set_axis(self):
if self.degrees == 2:
axis = self.random_state.random(3) - 0.5
self.axis = axis / np.linalg.norm(axis)
self.angle = 0
[docs]
def rotate_by_matrix(self, matrix, ignore_constraint=True):
"""
rotate
Args:
matrix: 3*3 rotation matrix
"""
if not ignore_constraint:
if self.degrees == 0:
raise ValueError("cannot rotate")
if self.degrees == 1:
axis = self.axis
vec = Rotation.from_matrix(matrix).as_rotvec()
if angle(vec, self.axis) > 1e-2 and angle(vec, -self.axis) > 1e-2:
raise ValueError("must rotate along the given axis")
else:
axis = None
matrix = matrix.dot(self.matrix)
return Orientation(matrix, self.degrees, axis, self.random_state)
[docs]
def get_matrix(self, angle="random"):
"""
Generate a 3x3 rotation matrix consistent with the orientation's
constraints. Allows for specification of an angle (possibly random) to
rotate about the constraint axis.
Args:
angle: an angle to rotate about the constraint axis. If "random",
chooses a random rotation angle. If self.degrees==2, chooses a
random 3d rotation matrix to multiply by. If the original matrix
is wanted, set angle=0, or call self.matrix
Returns:
a 3x3 rotation (and/or inversion) matrix (numpy array)
"""
if self.degrees == 2:
if angle == "random":
axis = self.random_state.random(3)
axis = axis / np.linalg.norm(axis)
angle = self.random_state.random() * np.pi * 2
else:
axis = self.axis
return Rotation.from_rotvec(angle * axis).as_matrix()
elif self.degrees == 1:
angle = self.random_state.random() * np.pi * 2 if angle == "random" else self.angle
return Rotation.from_rotvec(angle * self.axis).as_matrix()
elif self.degrees == 0:
return self.matrix
return None
[docs]
def get_op(self): # , angle=None):
"""
Generate a SymmOp object consistent with the orientation's constraints.
Allows for specification of an angle (possibly random) to rotate about
the constraint axis.
Args:
angle: an angle to rotate about the constraint axis. If "random",
chooses a random rotation angle. If self.degrees==2, chooses a
random 3d rotation matrix to multiply by. If the original matrix
is wanted, set angle=0, or call self.matrix
Returns:
pymatgen.core.structure. SymmOp object
"""
# if angle is not None:
# self.change_orientation(angle)
return SymmOp.from_rotation_and_translation(self.matrix, [0, 0, 0])
[docs]
def random_orientation(self):
"""
Applies random rotation (if possible) and returns a new orientation with
the new base matrix.
Returns:
a new orientation object with a different base rotation matrix
"""
self.change_orientation()
return self
[docs]
def get_Euler_angles(self):
"""
get the Euler angles
"""
return self.r.as_euler("zxy", degrees=True)
[docs]
def get_inertia_tensor(coords, weights=None):
"""
Calculate the symmetric inertia tensor for a molecule.
Args:
coords: [N, 3] array of coordinates
Returns:
a 3x3 numpy array representing the inertia tensor
"""
if weights is None:
weights = np.ones(len(coords))
coords -= np.mean(coords, axis=0)
Inertia = np.zeros([3, 3])
Inertia[0, 0] = np.sum(weights * coords[:, 1] ** 2 + weights * coords[:, 2] ** 2)
Inertia[1, 1] = np.sum(weights * coords[:, 0] ** 2 + weights * coords[:, 2] ** 2)
Inertia[2, 2] = np.sum(weights * coords[:, 0] ** 2 + weights * coords[:, 1] ** 2)
Inertia[0, 1] = Inertia[1, 0] = -np.sum(weights * coords[:, 0] * coords[:, 1])
Inertia[0, 2] = Inertia[2, 0] = -np.sum(weights * coords[:, 0] * coords[:, 2])
Inertia[1, 2] = Inertia[2, 1] = -np.sum(weights * coords[:, 1] * coords[:, 2])
return Inertia
[docs]
def reoriented_molecule(mol):
"""
Align a molecule so that its principal axes are aligned with the coordinate axes.
Reorients the molecule by computing its inertia tensor and rotating it such that
the principal axes align with the x, y, z coordinate axes.
Args:
mol (Molecule): A pymatgen Molecule object to reorient.
Returns:
tuple:
- mol (Molecule): A reoriented copy of the input molecule
- P (ndarray): The 3x3 rotation matrix used to align the molecule
"""
coords = mol.cart_coords
numbers = mol.atomic_numbers
coords -= np.mean(coords, axis=0)
A = get_inertia_tensor(coords)
# Store the eigenvectors of the inertia tensor
P = np.linalg.eigh(A)[1]
if np.linalg.det(P) < 0:
P[:, 0] *= -1
coords = np.dot(coords, P)
return Molecule(numbers, coords), P
[docs]
def is_compatible_symmetry(mol, wp):
"""
Tests if a molecule meets the symmetry requirements of a Wyckoff position
Args:
mol: a pymatgen Molecule object.
wp: a pyxtal.symmetry.Wyckoff_position object
"""
# For single atoms, there are no constraints
if len(mol) == 1 or wp.index == 0:
return True
pga = PointGroupAnalyzer(mol)
return all(pga.is_valid_op(op) for op in wp.get_site_symm_wo_translation())
[docs]
def make_graph(mol, tol=0.2, ignore_HH=False, debug=False):
"""
make graph object for the input molecule
Args:
mol: pymatgen Molecule object
tol (float): Tolerance for bond length matching
ignore_HH (bool): If True, ignore H-H bonds
Returns:
G: a networkx Graph object representing the molecule's connectivity
"""
# print("making graphs")
count = 0
G = nx.Graph()
names = {}
for i, site in enumerate(mol._sites):
names[i] = site.specie.value
if names[i] not in ["C", "H", "O", "N", "S", "P", "Si", "F", "Cl", "Br", "I"]:
raise ValueError(f"{names[i]} is not supported")
for i in range(len(mol) - 1):
site1 = mol.sites[i]
for j in range(i + 1, len(mol)):
site2 = mol.sites[j]
key = f"{names[i]:s}-{names[j]:s}"
if site1.distance(site2) < bonds[key]:
add = True
if ignore_HH and (names[i] == "H" and names[j] == "H"):
add = False
if add:
G.add_edge(i, j)
if debug:
count += 1
print(key, site1.distance(site2), count)
nx.set_node_attributes(G, names, "name")
return G
[docs]
def compare_mol_connectivity(mol1, mol2, ignore_name=False, ignore_HH=False, debug=False):
"""
Compare two molecules by connectivity
Args:
mol1: pymatgen Molecule object
mol2: pymatgen Molecule object
ignore_name (bool): If True, ignore the atom names in the comparison
ignore_HH (bool): If True, ignore the H-H bonds in the comparison
Returns:
tuple: (is_isomorphic, mapping)
- is_isomorphic (bool): True if the two molecules are isomorphic
- mapping (dict): A dictionary mapping nodes from mol1 to mol2
"""
G1 = make_graph(mol1, ignore_HH=ignore_HH, debug=debug)
G2 = make_graph(mol2, ignore_HH=ignore_HH, debug=debug)
if ignore_name:
GM = nx.isomorphism.GraphMatcher(G1, G2)
else:
fun = lambda n1, n2: n1["name"] == n2["name"]
GM = nx.isomorphism.GraphMatcher(G1, G2, node_match=fun)
return GM.is_isomorphic(), GM.mapping
if __name__ == "__main__":
smiles = "CCN1C(=O)c2ccc3C(=O)N(CC)C(=O)c4ccc(C1=O)c2c34"
ans1 = [(0, 1, 2, 20), (13, 12, 11, 14)]
print(ans1)
ans2 = find_rotor_from_smile(smiles)
print(ans2)
assert ans1 == ans2
smiles = "Nc1c(Cl)cc(cc1N(=O)=O)N(=O)=O"
ans2 = find_rotor_from_smile(smiles)
print(ans2)
ans1 = [(6, 5, 11, 13), (6, 7, 8, 10)]
print(ans1)
assert ans1 == ans2
smiles = "COc1cc(C=O)ccc1O"
ans2 = find_rotor_from_smile(smiles)
print(ans2)
ans1 = [(0, 1, 2, 9), (6, 5, 4, 7)]
print(ans1)
assert ans1 == ans2
mol1_file = "ref.xyz"
mol2_file = "wrong.xyz"
mol1 = Molecule.from_file(mol1_file)
mol2 = Molecule.from_file(mol2_file)
compare_mol_connectivity(mol1, mol2, debug=True)